Ονομασία του προϊόντος |
3-Fluoro-4-methylbenzonitrile |
Συνώνυμα |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
MF |
C8H6FN |
Μοριακό βάρος |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
CAS ΟΧΙ |
170572-49-3 |
Μοριακή δομή |
|
Πυκνότητα |
1.117g/cm3 |
Σημείο τήξης |
48-50℃ |
Σημείο βρασμού |
215.069°C at 760 mmHg |
Δείκτης διάθλασης |
1.508 |
Σημείο ανάφλεξης |
90.3°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|