Nazwa produktu: |
3-Fluoro-4-methylbenzonitrile |
Synonimy |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
MF |
C8H6FN |
Masie cząsteczkowej |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
Nr CAS |
170572-49-3 |
Struktury molekularnej |
|
Gęstość |
1.117g/cm3 |
Temperatura topnienia |
48-50℃ |
Temperatura wrzenia |
215.069°C at 760 mmHg |
Współczynnik załamania |
1.508 |
Temperatura zapłonu |
90.3°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|