product Name |
3-methyl-5-phenyl-4-isoxazolecarboxylic acid |
Synonyms |
3-methyl-5-phenylisoxazole-4-carboxylic acid |
Molecular Formula |
C11H9NO3 |
Molecular Weight |
203.1941 |
InChI |
InChI=1/C11H9NO3/c1-7-9(11(13)14)10(15-12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
CAS Registry Number |
17153-21-8 |
Molecular Structure |
|
Density |
1.274g/cm3 |
Melting point |
191℃ |
Boiling point |
362.079°C at 760 mmHg |
Refractive index |
1.579 |
Flash point |
172.779°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|