نام محصول |
3-methyl-5-phenyl-4-isoxazolecarboxylic acid |
مترادف |
3-methyl-5-phenylisoxazole-4-carboxylic acid |
میدان مغناطیسی |
C11H9NO3 |
وزن مولکولی |
203.1941 |
InChI |
InChI=1/C11H9NO3/c1-7-9(11(13)14)10(15-12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
شماره سیایاس |
17153-21-8 |
ساختار مولکولی |
|
تراکم |
1.274g/cm3 |
نقطه ذوب |
191℃ |
نقطه غلیان |
362.079°C at 760 mmHg |
ضریب شکست |
1.579 |
نقطه اشتعال |
172.779°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|