שם המוצר |
2,3-Dichlorothiophene |
נרדפות |
2,3-dichloro-thiophene |
מולקולרית פורמולה |
C4H2Cl2S |
משקל מולקולרי |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
מספר CAS |
17249-79-5;17249-29-5 |
מבנה מולקולרי |
|
צפיפות |
1.488g/cm3 |
נקודת ההתוך |
-26℃ |
נקודת רתיחה |
170.7°C at 760 mmHg |
משקל סגולי |
1.584 |
נקודת הבזק |
68.9°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|