produktnavn |
2,3-Dichlorothiophene |
Synonymer |
2,3-dichloro-thiophene |
Molekylær Formel |
C4H2Cl2S |
Molekylvekt |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS-nummer |
17249-79-5;17249-29-5 |
Molecular Structure |
|
Tetthet |
1.488g/cm3 |
Smeltepunkt |
-26℃ |
Kokepunkt |
170.7°C at 760 mmHg |
Brytningsindeks |
1.584 |
Flammepunktet |
68.9°C |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|