उत्पाद का नाम |
Ethyl 3,5-dichloro-4-hydroxybenzoate |
समानार्थी |
3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
आणविक फार्मूला |
C9H8Cl2O3 |
आण्विक वजन |
235.064 |
InChI |
InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
कैस रजिस्टी संख्या |
17302-82-8 |
EINECS |
241-331-2 |
आणविक संरचना |
|
घनत्व |
1.414g/cm3 |
गलनांक |
98-102℃ |
उबलने का समय |
316.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.567 |
फ्लैश प्वाइंट |
145.3°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|