نام محصول |
Ethyl 3,5-dichloro-4-hydroxybenzoate |
مترادف |
3,5-Dichloro-4-hydroxybenzoic acid ethyl ester |
میدان مغناطیسی |
C9H8Cl2O3 |
وزن مولکولی |
235.064 |
InChI |
InChI=1/C9H8Cl2O3/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4,12H,2H2,1H3 |
شماره سیایاس |
17302-82-8 |
تعداد کمیسیون اروپایی |
241-331-2 |
ساختار مولکولی |
|
تراکم |
1.414g/cm3 |
نقطه ذوب |
98-102℃ |
نقطه غلیان |
316.6°C at 760 mmHg |
ضریب شکست |
1.567 |
نقطه اشتعال |
145.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|