상품명칭 |
3,4,5-trifluorobenzoyl chloride |
분자식 |
C7H2ClF3O |
분자량 |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
cas번호 |
177787-26-7 |
분자 구조 |
|
밀도 |
1.514g/cm3 |
비등점 |
184.7°C at 760 mmHg |
굴절 지수 |
1.479 |
인화점 |
65.5°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|