Nama produk |
3,4,5-trifluorobenzoyl chloride |
MF |
C7H2ClF3O |
Berat Molekul |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
CAS NO |
177787-26-7 |
Struktur Molekul |
|
Kepadatan |
1.514g/cm3 |
Titik didih |
184.7°C at 760 mmHg |
Indeks bias |
1.479 |
Titik nyala |
65.5°C |
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|