product Name |
1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
Synonyms |
1,6-Dibromo-2-naphthol-3-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylate |
Molecular Formula |
C11H5Br2O3 |
Molecular Weight |
344.9641 |
InChI |
InChI=1/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16)/p-1 |
CAS Registry Number |
1779-10-8 |
EINECS |
217-214-7 |
Molecular Structure |
|
Melting point |
251-253℃ |
Boiling point |
427.6°C at 760 mmHg |
Flash point |
212.4°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|