Ürün Adı |
1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
Eş anlamlı |
1,6-Dibromo-2-naphthol-3-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylate |
Moleküler Formülü |
C11H5Br2O3 |
Molekül Ağırlığı |
344.9641 |
InChI |
InChI=1/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16)/p-1 |
CAS kayıt numarası |
1779-10-8 |
EINECS |
217-214-7 |
Moleküler Yapısı |
|
Ergime noktası |
251-253℃ |
Kaynama noktası |
427.6°C at 760 mmHg |
Alevlenme noktası |
212.4°C |
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|