نام محصول |
alpha-Methylbenzyl cyanide |
مترادف |
alpha-Methylphenylacetonitrile; 2-Phenylpropionitrile; 2-phenylpropiononitrile; hydratroponitrile; 2-Phenylpropionitrile (Alpha-); α-Methylphenylacetonitrile; 2-phenylpropanenitrile; (2S)-2-phenylpropanenitrile; (2R)-2-phenylpropanenitrile; 2-(o-tolyl)acetonitrile; 2-methylbenzeneacetonitrile; 2-Phenyl propionitrile |
میدان مغناطیسی |
C9H9N |
وزن مولکولی |
131.1745 |
InChI |
InChI=1/C9H9N/c1-8-4-2-3-5-9(8)6-7-10/h2-5H,6H2,1H3 |
شماره سیایاس |
1823-91-2 |
تعداد کمیسیون اروپایی |
217-354-9 |
ساختار مولکولی |
|
تراکم |
0.994g/cm3 |
نقطه غلیان |
244°C at 760 mmHg |
ضریب شکست |
1.526 |
نقطه اشتعال |
111.3°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|