상품명칭 |
alpha-Methylbenzyl cyanide |
별명 |
alpha-Methylphenylacetonitrile; 2-Phenylpropionitrile; 2-phenylpropiononitrile; hydratroponitrile; 2-Phenylpropionitrile (Alpha-); α-Methylphenylacetonitrile; 2-phenylpropanenitrile; (2S)-2-phenylpropanenitrile; (2R)-2-phenylpropanenitrile; 2-(o-tolyl)acetonitrile; 2-methylbenzeneacetonitrile; 2-Phenyl propionitrile |
분자식 |
C9H9N |
분자량 |
131.1745 |
InChI |
InChI=1/C9H9N/c1-8-4-2-3-5-9(8)6-7-10/h2-5H,6H2,1H3 |
cas번호 |
1823-91-2 |
EC번호 |
217-354-9 |
분자 구조 |
|
밀도 |
0.994g/cm3 |
비등점 |
244°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
111.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|