상품명칭 |
2,3-Dimethylbenzeneboronic acid |
별명 |
2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
분자식 |
C8H11BO2 |
분자량 |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
cas번호 |
183158-34-1 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
녹는 점 |
174-180℃ |
비등점 |
312.6°C at 760 mmHg |
굴절 지수 |
1.523 |
인화점 |
142.8°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|