Nama produk |
2,3-Dimethylbenzeneboronic acid |
Sinonim |
2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
MF |
C8H11BO2 |
Berat Molekul |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
CAS NO |
183158-34-1 |
Struktur Molekul |
|
Kepadatan |
1.07g/cm3 |
Titik lebur |
174-180℃ |
Titik didih |
312.6°C at 760 mmHg |
Indeks bias |
1.523 |
Titik nyala |
142.8°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|