שם המוצר |
2-Octenoic acid |
נרדפות |
Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
מולקולרית פורמולה |
C8H13O2 |
משקל מולקולרי |
141.1882 |
InChI |
InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
מספר CAS |
1871-67-6 |
EINECS |
217-491-4 |
מבנה מולקולרי |
|
נקודת ההתוך |
5-6℃ |
נקודת רתיחה |
260.2°C at 760 mmHg |
נקודת הבזק |
151.1°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|