2-Octenoic acid

نام محصول	2-Octenoic acid
مترادف	Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate
میدان مغناطیسی	C₈H₁₃O₂
وزن مولکولی	141.1882
InChI	InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1
شماره سیایاس	1871-67-6
تعداد کمیسیون اروپایی	217-491-4
ساختار مولکولی
نقطه ذوب	5-6℃
نقطه غلیان	260.2°C at 760 mmHg
نقطه اشتعال	151.1°C
خطر نمادها	C:Corrosive;
کدهای خطر	R34:Causes burns.;
توضیحات ایمنی	S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;