שם המוצר |
4-Bromo-3-methoxyaniline |
נרדפות |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
מולקולרית פורמולה |
C13H10N2O4 |
משקל מולקולרי |
258.2295 |
InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
מספר CAS |
19056-40-7 |
מבנה מולקולרי |
|
צפיפות |
1.381g/cm3 |
נקודת רתיחה |
467°C at 760 mmHg |
משקל סגולי |
1.655 |
נקודת הבזק |
236.2°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|