Nama produk |
4-Bromo-3-methoxyaniline |
Sinonim |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
MF |
C13H10N2O4 |
Berat Molekul |
258.2295 |
InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
CAS NO |
19056-40-7 |
Struktur Molekul |
|
Kepadatan |
1.381g/cm3 |
Titik didih |
467°C at 760 mmHg |
Indeks bias |
1.655 |
Titik nyala |
236.2°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|