název výrobku |
3,5-Dihydroxybenzonitrile |
Molekulární vzorec |
C7H5NO2 |
Molekulová hmotnost |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H |
Registrační číslo CAS |
19179-36-3 |
EINECS |
242-859-6 |
Molekulární struktura |
|
Hustota |
1.42g/cm3 |
Bod varu |
336.4°C at 760 mmHg |
Index lomu |
1.647 |
Bod vzplanutí |
157.2°C |
Riziko Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|