상품명칭 |
3,5-Dihydroxybenzonitrile |
분자식 |
C7H5NO2 |
분자량 |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H |
cas번호 |
19179-36-3 |
EC번호 |
242-859-6 |
분자 구조 |
|
밀도 |
1.42g/cm3 |
비등점 |
336.4°C at 760 mmHg |
굴절 지수 |
1.647 |
인화점 |
157.2°C |
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|