Название продукта |
2,6-Dimethylphenyl isothiocyanate |
Синонимы |
2,6-Dimethylisothiocyanatobenzene; 2-isothiocyanato-1,3-dimethylbenzene |
Молекулярная формула |
C9H9NS |
Молекулярный вес |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-7-4-3-5-8(2)9(7)10-6-11/h3-5H,1-2H3 |
Регистрационный номер CAS |
19241-16-8 |
EINECS |
242-906-0 |
Молекулярная структура |
|
Плотность |
1.01g/cm3 |
Точка кипения |
267°C at 760 mmHg |
Показатель преломления |
1.554 |
Температура вспышки |
116.7°C |
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|