اسم المنتج |
2,6-Dimethylphenyl isothiocyanate |
الاسم المستعار |
2,6-Dimethylisothiocyanatobenzene; 2-isothiocyanato-1,3-dimethylbenzene |
الصيغة الجزيئية |
C9H9NS |
الوزن الجزيئي الغرامي |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-7-4-3-5-8(2)9(7)10-6-11/h3-5H,1-2H3 |
إستراتيجية المساعدة القطرية |
19241-16-8 |
المفوضية الأوروبية رقم |
242-906-0 |
بنية جزيئية |
|
كثافة |
1.01g/cm3 |
نقطة الغليان |
267°C at 760 mmHg |
معامل الإنكسار |
1.554 |
نقطة الوميض |
116.7°C |
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|