상품명칭 |
Propargylpropionate(Propionicacidpropargylester) |
별명 |
Propargyl propionate (Propionic acid propargyl ester); Propargyl propionate; Propionic acid propargyl ester; prop-2-yn-1-yl propanoate |
분자식 |
C6H8O2 |
분자량 |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-3-5-8-6(7)4-2/h1H,4-5H2,2H3 |
cas번호 |
1932-92-9 |
EC번호 |
217-695-3 |
분자 구조 |
|
밀도 |
0.976g/cm3 |
비등점 |
146.4°C at 760 mmHg |
굴절 지수 |
1.426 |
인화점 |
42.1°C |
리스크 규칙 |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|