Naam product |
Propargylpropionate(Propionicacidpropargylester) |
Synoniemen |
Propargyl propionate (Propionic acid propargyl ester); Propargyl propionate; Propionic acid propargyl ester; prop-2-yn-1-yl propanoate |
MF |
C6H8O2 |
Molecuulgewicht |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-3-5-8-6(7)4-2/h1H,4-5H2,2H3 |
CAS-nummer |
1932-92-9 |
EINECS |
217-695-3 |
Moleculaire Structuur |
|
Dichtheid |
0.976g/cm3 |
Kookpunt |
146.4°C at 760 mmHg |
Brekingsindex |
1.426 |
Vlampunt |
42.1°C |
Risico-codes |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|