Produkt-Name |
1,4-difluoro-2,5-dimethoxybenzene |
Molekulare Formel |
C8H8F2O2 |
Molecular Weight |
174.1447 |
InChI |
InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
CAS Registry Number |
199866-90-5 |
Molecular Structure |
|
Dichte |
1.193g/cm3 |
Siedepunkt |
193.7°C at 760 mmHg |
Brechungsindex |
1.455 |
Flammpunkt |
77.4°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|