termék neve |
1,4-difluoro-2,5-dimethoxybenzene |
MF |
C8H8F2O2 |
Molekulatömeg |
174.1447 |
InChI |
InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
CAS-szám |
199866-90-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.193g/cm3 |
Forráspont |
193.7°C at 760 mmHg |
Törésmutató |
1.455 |
Gyulladáspont |
77.4°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|