اسم المنتج |
benzyl 4-brornophenyl ketone |
الاسم المستعار |
4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
الصيغة الجزيئية |
C14H11BrO |
الوزن الجزيئي الغرامي |
275.1405 |
InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
إستراتيجية المساعدة القطرية |
2001-29-8 |
بنية جزيئية |
|
كثافة |
1.39g/cm3 |
درجة الإنصهار |
112-116℃ |
نقطة الغليان |
383.2°C at 760 mmHg |
معامل الإنكسار |
1.608 |
نقطة الوميض |
84.6°C |
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|