Ürün Adı |
benzyl 4-brornophenyl ketone |
Eş anlamlı |
4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
Moleküler Formülü |
C14H11BrO |
Molekül Ağırlığı |
275.1405 |
InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
CAS kayıt numarası |
2001-29-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.39g/cm3 |
Ergime noktası |
112-116℃ |
Kaynama noktası |
383.2°C at 760 mmHg |
Kırılma indisi |
1.608 |
Alevlenme noktası |
84.6°C |
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|