Nome del prodotto |
3-Chloro-4-fluoroanisole |
Sinonimi |
2-chloro-1-fluoro-4-methoxybenzene |
Formula molecolare |
C7H6ClFO |
Peso Molecolare |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
Numero CAS |
202925-07-3 |
Struttura molecolare |
|
Densità |
1.239g/cm3 |
Punto di ebollizione |
202.8°C at 760 mmHg |
Indice di rifrazione |
1.495 |
Punto d'infiammabilità |
76.4°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|