اسم المنتج |
3-Chloro-4-fluoroanisole |
الاسم المستعار |
2-chloro-1-fluoro-4-methoxybenzene |
الصيغة الجزيئية |
C7H6ClFO |
الوزن الجزيئي الغرامي |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
202925-07-3 |
بنية جزيئية |
|
كثافة |
1.239g/cm3 |
نقطة الغليان |
202.8°C at 760 mmHg |
معامل الإنكسار |
1.495 |
نقطة الوميض |
76.4°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|