product Name |
Methyl 3-(2-hydroxyphenyl)propionate |
Synonyms |
Methyl 3-(2-hydroxyphenyl)propanoate |
Molecular Formula |
C10H12O3 |
Molecular Weight |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-13-10(12)7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3 |
CAS Registry Number |
20349-89-7 |
Molecular Structure |
|
Density |
1.146g/cm3 |
Melting point |
40℃ |
Boiling point |
280.2°C at 760 mmHg |
Refractive index |
1.532 |
Flash point |
116.6°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|