Nazwa produktu: |
Methyl 3-(2-hydroxyphenyl)propionate |
Synonimy |
Methyl 3-(2-hydroxyphenyl)propanoate |
MF |
C10H12O3 |
Masie cząsteczkowej |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-13-10(12)7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3 |
Nr CAS |
20349-89-7 |
Struktury molekularnej |
|
Gęstość |
1.146g/cm3 |
Temperatura topnienia |
40℃ |
Temperatura wrzenia |
280.2°C at 760 mmHg |
Współczynnik załamania |
1.532 |
Temperatura zapłonu |
116.6°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|