نام محصول |
2,3-Dichlorocinnamic acid |
مترادف |
(2E)-3-(2,3-dichlorophenyl)prop-2-enoate; (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
میدان مغناطیسی |
C9H6Cl2O2 |
وزن مولکولی |
217.0487 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+ |
شماره سیایاس |
20595-44-2 |
ساختار مولکولی |
|
تراکم |
1.457g/cm3 |
نقطه غلیان |
363°C at 760 mmHg |
ضریب شکست |
1.637 |
نقطه اشتعال |
173.3°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|