produktnavn |
2,3-Dichlorocinnamic acid |
Synonymer |
(2E)-3-(2,3-dichlorophenyl)prop-2-enoate; (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid |
Molekylær Formel |
C9H6Cl2O2 |
Molekylvekt |
217.0487 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+ |
CAS-nummer |
20595-44-2 |
Molecular Structure |
|
Tetthet |
1.457g/cm3 |
Kokepunkt |
363°C at 760 mmHg |
Brytningsindeks |
1.637 |
Flammepunktet |
173.3°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|