termék neve |
4-(1H-pyrazol-1-yl)benzoyl chloride |
Szinonimák |
4-pyrazol-1-ylbenzoyl chloride |
MF |
C10H7ClN2O |
Molekulatömeg |
206.6284 |
InChI |
InChI=1/C10H7ClN2O/c11-10(14)8-2-4-9(5-3-8)13-7-1-6-12-13/h1-7H |
CAS-szám |
220461-83-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.303g/cm3 |
Olvadáspont |
118℃ |
Forráspont |
319.861°C at 760 mmHg |
Törésmutató |
1.624 |
Gyulladáspont |
147.247°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|