4-(1H-pyrazol-1-yl)benzoyl chloride

اسم المنتج	4-(1H-pyrazol-1-yl)benzoyl chloride
الاسم المستعار	4-pyrazol-1-ylbenzoyl chloride
الصيغة الجزيئية	C₁₀H₇ClN₂O
الوزن الجزيئي الغرامي	206.6284
InChI	InChI=1/C10H7ClN2O/c11-10(14)8-2-4-9(5-3-8)13-7-1-6-12-13/h1-7H
إستراتيجية المساعدة القطرية	220461-83-6
بنية جزيئية
كثافة	1.303g/cm³
درجة الإنصهار	118℃
نقطة الغليان	319.861°C at 760 mmHg
معامل الإنكسار	1.624
نقطة الوميض	147.247°C
علامات على البضائع الخطرة	C:Corrosive;
خطر المصطلحات	R34:Causes burns.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;