product Name |
ethyl 2-(5-bromo-2-thienyl)-2-oxoacetate |
Synonyms |
Ethyl (5-bromothien-2-yl)glyoxylate; ethyl (5-bromothiophen-2-yl)(oxo)acetate |
Molecular Formula |
C8H7BrO3S |
Molecular Weight |
263.1084 |
InChI |
InChI=1/C8H7BrO3S/c1-2-12-8(11)7(10)5-3-4-6(9)13-5/h3-4H,2H2,1H3 |
CAS Registry Number |
22098-10-8 |
Molecular Structure |
|
Density |
1.612g/cm3 |
Melting point |
50℃ |
Boiling point |
325°C at 760 mmHg |
Refractive index |
1.568 |
Flash point |
150.3°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|