Ürün Adı |
ethyl 2-(5-bromo-2-thienyl)-2-oxoacetate |
Eş anlamlı |
Ethyl (5-bromothien-2-yl)glyoxylate; ethyl (5-bromothiophen-2-yl)(oxo)acetate |
Moleküler Formülü |
C8H7BrO3S |
Molekül Ağırlığı |
263.1084 |
InChI |
InChI=1/C8H7BrO3S/c1-2-12-8(11)7(10)5-3-4-6(9)13-5/h3-4H,2H2,1H3 |
CAS kayıt numarası |
22098-10-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.612g/cm3 |
Ergime noktası |
50℃ |
Kaynama noktası |
325°C at 760 mmHg |
Kırılma indisi |
1.568 |
Alevlenme noktası |
150.3°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|