उत्पाद का नाम |
n-Propyl methacrylate |
समानार्थी |
n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
आणविक फार्मूला |
C7H12O2 |
आण्विक वजन |
128.169 |
InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
कैस रजिस्टी संख्या |
2210-28-8 |
EINECS |
218-639-0 |
आणविक संरचना |
|
घनत्व |
0.899g/cm3 |
उबलने का समय |
141°C at 760 mmHg |
अपवर्तक सूचकांक |
1.416 |
फ्लैश प्वाइंट |
34.7°C |
खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|