نام محصول |
n-Propyl methacrylate |
مترادف |
n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
میدان مغناطیسی |
C7H12O2 |
وزن مولکولی |
128.169 |
InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
شماره سیایاس |
2210-28-8 |
تعداد کمیسیون اروپایی |
218-639-0 |
ساختار مولکولی |
|
تراکم |
0.899g/cm3 |
نقطه غلیان |
141°C at 760 mmHg |
ضریب شکست |
1.416 |
نقطه اشتعال |
34.7°C |
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|