Produkt-Name |
2-Phenoxybenzoic acid |
Synonyme |
2-Carboxydiphenyl ether; 2-phenoxybenzoate |
Molekulare Formel |
C13H9O3 |
Molecular Weight |
213.2093 |
InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
CAS Registry Number |
2243-42-7 |
EINECS |
218-811-5 |
Molecular Structure |
|
Schmelzpunkt |
111-115℃ |
Siedepunkt |
343.3°C at 760 mmHg |
Flammpunkt |
132°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|