Naam product |
2-Phenoxybenzoic acid |
Synoniemen |
2-Carboxydiphenyl ether; 2-phenoxybenzoate |
MF |
C13H9O3 |
Molecuulgewicht |
213.2093 |
InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
CAS-nummer |
2243-42-7 |
EINECS |
218-811-5 |
Moleculaire Structuur |
|
Smeltpunt |
111-115℃ |
Kookpunt |
343.3°C at 760 mmHg |
Vlampunt |
132°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|