Naam product |
4-Hydroxyphenyl benzoate |
Synoniemen |
Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
MF |
C13H10O3 |
Molecuulgewicht |
214.2167 |
InChI |
InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
CAS-nummer |
2444-19-1 |
EINECS |
219-479-4 |
Moleculaire Structuur |
|
Dichtheid |
1.25g/cm3 |
Kookpunt |
376.6°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
164.7°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|