اسم المنتج |
4-Hydroxyphenyl benzoate |
الاسم المستعار |
Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
الصيغة الجزيئية |
C13H10O3 |
الوزن الجزيئي الغرامي |
214.2167 |
InChI |
InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
إستراتيجية المساعدة القطرية |
2444-19-1 |
المفوضية الأوروبية رقم |
219-479-4 |
بنية جزيئية |
|
كثافة |
1.25g/cm3 |
نقطة الغليان |
376.6°C at 760 mmHg |
معامل الإنكسار |
1.615 |
نقطة الوميض |
164.7°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|