product Name |
(Methylthio)acetic acid |
Synonyms |
NSC 263480; (methylsulfanyl)acetic acid |
Molecular Formula |
C3H6O2S |
Molecular Weight |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
CAS Registry Number |
2444-37-3 |
EINECS |
219-483-6 |
Molecular Structure |
|
Density |
1.224g/cm3 |
Melting point |
13-131℃ |
Boiling point |
225.9°C at 760 mmHg |
Refractive index |
1.5 |
Flash point |
90.4°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|