نام محصول |
(Methylthio)acetic acid |
مترادف |
NSC 263480; (methylsulfanyl)acetic acid |
میدان مغناطیسی |
C3H6O2S |
وزن مولکولی |
106.1435 |
InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
شماره سیایاس |
2444-37-3 |
تعداد کمیسیون اروپایی |
219-483-6 |
ساختار مولکولی |
|
تراکم |
1.224g/cm3 |
نقطه ذوب |
13-131℃ |
نقطه غلیان |
225.9°C at 760 mmHg |
ضریب شکست |
1.5 |
نقطه اشتعال |
90.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|