product Name |
n-Decylboronic acid |
Synonyms |
n-Decaneboronic acid; decylboronic acid |
Molecular Formula |
C10H23BO2 |
Molecular Weight |
186.0994 |
InChI |
InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
CAS Registry Number |
24464-63-9 |
Molecular Structure |
|
Density |
0.883g/cm3 |
Boiling point |
297.1°C at 760 mmHg |
Refractive index |
1.434 |
Flash point |
133.5°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|