اسم المنتج |
n-Decylboronic acid |
الاسم المستعار |
n-Decaneboronic acid; decylboronic acid |
الصيغة الجزيئية |
C10H23BO2 |
الوزن الجزيئي الغرامي |
186.0994 |
InChI |
InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
إستراتيجية المساعدة القطرية |
24464-63-9 |
بنية جزيئية |
|
كثافة |
0.883g/cm3 |
نقطة الغليان |
297.1°C at 760 mmHg |
معامل الإنكسار |
1.434 |
نقطة الوميض |
133.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|